CAS 50735-34-7

Methyl 2-amino-5-bromonicotinate

Description:

Methyl 2-amino-5-bromonicotinate, with the CAS number 50735-34-7, is an organic compound that belongs to the class of nicotinic acid derivatives. It features a pyridine ring, which is characteristic of nicotinic compounds, and contains both an amino group and a bromine substituent, contributing to its reactivity and potential biological activity. The presence of the methyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions and applications. This compound may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals, owing to the functional groups present. Additionally, the bromine atom can impart unique electronic properties, influencing the compound's reactivity and interaction with biological targets. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, Methyl 2-amino-5-bromonicotinate is a versatile compound with applications in medicinal chemistry and material science.

Formula: C₇H₇BrN₂O₂

InChI: InChI=1S/C7H7BrN2O2/c1-12-7(11)5-2-4(8)3-10-6(5)9/h2-3H,1H3,(H2,9,10)

InChI key: InChIKey=POWKBBOOIZBIRZ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(N)N=CC(Br)=C1

Synonyms:

• 3-Pyridinecarboxylic acid, 2-amino-5-bromo-, methyl ester
• Methyl 2-Amino-5-Bromopyridine-3-Carboxylate
• Methyl 2-amino-5-bromonicotinate
• Methyl 2-amino-5-bromonicotinate

Methyl 2-amino-5-bromopyridine-3-carboxylate

CAS: 50735-34-7

Formula: C₇H₇BrN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 231.0467

Ref: IN-DA003RMW

Methyl 2-amino-5-bromonicotinate

CAS: 50735-34-7

Methyl 2-amino-5-bromonicotinate

Purity: 98%

Color and Shape: Solid

Molecular weight: 231.05g/mol

Ref: 54-OR110269

Methyl 2-Amino-5-bromonicotinate

CAS: 50735-34-7

Formula: C₇H₇BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 231.049

Ref: 10-F066900