CAS 50735-55-2
:2-AMINO-N-(4-BROMOPHENYL)BENZAMIDE
Description:
2-Amino-N-(4-bromophenyl)benzamide, with the CAS number 50735-55-2, is an organic compound characterized by the presence of an amine group, a bromophenyl substituent, and a benzamide structure. This compound typically appears as a solid and is soluble in organic solvents, reflecting its aromatic nature. The presence of the bromine atom introduces significant electronegativity, which can influence the compound's reactivity and interaction with biological systems. The amino group can participate in hydrogen bonding, enhancing its solubility in polar solvents and potentially affecting its biological activity. This compound may be of interest in pharmaceutical research due to its structural features, which could contribute to various biological activities, including potential anti-cancer properties. Additionally, the bromine substituent can serve as a handle for further chemical modifications, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.
Formula:C13H11BrN2O
InChI:InChI=1/C13H11BrN2O/c14-9-5-7-10(8-6-9)16-13(17)11-3-1-2-4-12(11)15/h1-8H,15H2,(H,16,17)
SMILES:c1ccc(c(c1)C(=O)Nc1ccc(cc1)Br)N
Synonyms:- 2-Amino-N-(4-bromophenyl)benzamide
- Benzamide, 2-amino-N-(4-bromophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.