CAS 50739-30-5
:(4S)-2-benzylthiazolidine-4-carboxylic acid
Description:
(4S)-2-benzylthiazolidine-4-carboxylic acid, with the CAS number 50739-30-5, is an organic compound characterized by its thiazolidine ring structure, which incorporates a sulfur atom and a carboxylic acid functional group. This compound features a benzyl group attached to the thiazolidine ring, contributing to its unique properties. The stereochemistry indicated by the (4S) designation suggests that the molecule has a specific three-dimensional arrangement, which can influence its biological activity and interactions. Typically, compounds like this may exhibit properties such as being soluble in polar solvents and having potential applications in pharmaceuticals, particularly in the development of drugs that target specific biological pathways. The presence of both the thiazolidine and carboxylic acid functionalities may also suggest potential reactivity in various chemical reactions, including esterification and amidation. Overall, (4S)-2-benzylthiazolidine-4-carboxylic acid is of interest in medicinal chemistry and could serve as a scaffold for further chemical modifications.
Formula:C11H13NO2S
InChI:InChI=1/C11H13NO2S/c13-11(14)9-7-15-10(12-9)6-8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2,(H,13,14)/t9-,10?/m1/s1
SMILES:c1ccc(cc1)CC1N[C@H](CS1)C(=O)O
Synonyms:- 2-Benzyl-thiazolidine-4-carboxylic
- Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Benzyl-1,3-thiazolidine-4-carboxylic acid
CAS:2-Benzyl-1,3-thiazolidine-4-carboxylic acid is a sulfur containing compound that is an ionizable, crystallographic, and spectroscopic compound. It has the ability to react with amino acids in the presence of heat. The vibrational spectrum of 2-benzyl-1,3-thiazolidine-4 carboxylic acid displays peaks at 1240 cm and 1450 cm. The x-ray crystallography data for 2BZTAC is available in the supplementary information.Formula:C11H13NO2SPurity:Min. 95%Molecular weight:223.29 g/mol
