CAS 50766-86-4

3-Nitrobutyrophenone

Description:

3-Nitrobutyrophenone is an organic compound characterized by its structure, which includes a butyrophenone moiety substituted with a nitro group at the 3-position of the aromatic ring. This compound typically appears as a yellow to orange crystalline solid. It is known for its role in various chemical reactions, particularly in organic synthesis, where it can serve as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the nitro group contributes to its reactivity, making it a potential candidate for electrophilic substitution reactions. Additionally, 3-Nitrobutyrophenone may exhibit specific physical properties such as solubility in organic solvents and varying melting and boiling points, which are influenced by its molecular structure. Safety data indicates that, like many nitro compounds, it should be handled with care due to potential toxicity and environmental hazards. Proper storage and handling protocols are essential to mitigate risks associated with exposure.

Formula: C₁₀H₁₁NO₃

InChI: InChI=1/C10H11NO3/c1-2-4-10(12)8-5-3-6-9(7-8)11(13)14/h3,5-7H,2,4H2,1H3

SMILES: CCCC(=O)c1cccc(c1)N(=O)=O

Synonyms:

• 1-(3-Nitrophenyl)-1-butanone
• 1-(3-Nitrophenyl)Butan-1-One

3-Nitrobutyrophenone

CAS: 50766-86-4

Please enquire for more information about 3-Nitrobutyrophenone including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₀H₁₁NO₃

Purity: Min. 95%

Molecular weight: 193.2 g/mol

Ref: 3D-FN147078