CAS 50786-32-8

2-Ethoxy-4-quinolinamine

Description:

2-Ethoxy-4-quinolinamine is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features an ethoxy group (-OCH2CH3) and an amino group (-NH2) at the 2 and 4 positions of the quinoline ring, respectively. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the presence of the ethoxy group, which enhances its hydrophobic character. The amino group can participate in hydrogen bonding, influencing its reactivity and potential applications in medicinal chemistry. 2-Ethoxy-4-quinolinamine may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of compounds with antimicrobial or anticancer properties. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound's unique structure and functional groups contribute to its chemical behavior and potential applications in various fields.

Formula: C₁₁H₁₂N₂O

InChI: InChI=1S/C11H12N2O/c1-2-14-11-7-9(12)8-5-3-4-6-10(8)13-11/h3-7H,2H2,1H3,(H2,12,13)

InChI key: InChIKey=KJHUIQISGCUIOK-UHFFFAOYSA-N

SMILES: NC=1C2=C(N=C(OCC)C1)C=CC=C2

Synonyms:

• 2-Ethoxy-4-quinolinamine
• 2-Ethoxy-quinolin-4-ylamine
• 4-Quinolinamine, 2-ethoxy-
• 2-Ethoxy-4-aminoquinoline