CAS 50789-45-2
:3-phenoxybenzonitrile
Description:
3-Phenoxybenzonitrile, with the CAS number 50789-45-2, is an organic compound characterized by its phenoxy and benzonitrile functional groups. It typically appears as a white to light yellow solid and is known for its aromatic properties due to the presence of benzene rings. The compound has a molecular formula that reflects its structure, comprising carbon, hydrogen, and nitrogen atoms. It is generally insoluble in water but soluble in organic solvents, which is common for many aromatic compounds. 3-Phenoxybenzonitrile is often utilized in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its chemical stability and reactivity can be influenced by the substituents on the aromatic rings, making it a subject of interest in research related to material science and medicinal chemistry. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly.
Formula:C13H9NO
InChI:InChI=1/C13H9NO/c14-10-11-5-4-8-13(9-11)15-12-6-2-1-3-7-12/h1-9H
SMILES:c1ccc(cc1)Oc1cccc(c1)C#N
Synonyms:- Benzonitrile, 3-phenoxy-
- 3-Phenoxybenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Phenoxybenzonitrile
CAS:3-Phenoxybenzonitrile is a diphenyl ether that can be used as an anti-cancer and pesticide. It has been shown to inhibit the growth of human cancer cells in vitro, and is effective against a number of insect pests. 3-Phenoxybenzonitrile is toxic to humans, but is less toxic than other phenoxybenzamines. 3-Phenoxybenzonitrile has also been shown to be carcinogenic, with parameters such as hydrogen chloride, optimization and chloride affecting its carcinogenicity. This chemical's toxicity depends on the functional group present at the 3-position. In the presence of chloride ions, it reacts with acetonitrile to form 1,2-dioxane and hydrogen chloride. The rate of this reaction will depend on the reaction time and temperature.
Formula:C13H9NOPurity:Min. 95%Molecular weight:195.22 g/mol



