CAS 50798-38-4

2-[(3-nitropyridin-2-yl)amino]ethanol

Description:

2-[(3-Nitropyridin-2-yl)amino]ethanol, with the CAS number 50798-38-4, is an organic compound characterized by the presence of a pyridine ring substituted with a nitro group and an aminoethanol moiety. This compound features a 3-nitropyridine structure, which contributes to its potential biological activity, and an ethanolamine group that enhances its solubility in polar solvents. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and interactions with biological targets. The amino group allows for hydrogen bonding, which can enhance its solubility and reactivity in various chemical environments. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological systems. Additionally, its stability and reactivity can be influenced by factors such as pH and the presence of other functional groups in a reaction mixture. Overall, 2-[(3-nitropyridin-2-yl)amino]ethanol is a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₇H₉N₃O₃

InChI: InChI=1/C7H9N3O3/c11-5-4-9-7-6(10(12)13)2-1-3-8-7/h1-3,11H,4-5H2,(H,8,9)

SMILES: c1cc(c(nc1)NCCO)N(=O)=O

Synonyms:

• Ethanol, 2-[(3-Nitro-2-Pyridinyl)Amino]-

2-[(3-nitro-2-pyridinyl)amino]ethanol

CAS: 50798-38-4

Formula: C₇H₉N₃O₃

Purity: 95.0%

Molecular weight: 183.167

Ref: 10-F313269