CAS 508-01-0
:Soyasapogenol A
Description:
Soyasapogenol A is a triterpenoid saponin derived from soybeans, specifically from the glycosides of soy saponins. It is characterized by its complex structure, which includes a steroid-like framework with multiple hydroxyl groups, contributing to its biological activity. This compound is known for its potential health benefits, including antioxidant properties and possible effects on cholesterol metabolism. Soyasapogenol A exhibits low solubility in water but is soluble in organic solvents, which is typical for many saponins. Its molecular structure allows it to interact with cell membranes, potentially influencing cellular processes. Additionally, it has been studied for its role in traditional medicine and its potential applications in functional foods and nutraceuticals. The compound's safety profile and efficacy are subjects of ongoing research, particularly in the context of its use as a dietary supplement. Overall, Soyasapogenol A represents a significant area of interest in both pharmacology and nutrition due to its diverse biological activities.
Formula:C30H50O4
InChI:InChI=1S/C30H50O4/c1-25(2)16-19-18-8-9-21-27(4)12-11-22(32)28(5,17-31)20(27)10-13-30(21,7)29(18,6)15-14-26(19,3)24(34)23(25)33/h8,19-24,31-34H,9-17H2,1-7H3/t19-,20+,21+,22-,23-,24+,26+,27-,28+,29+,30+/m0/s1
InChI key:InChIKey=CDDWAYFUFNQLRZ-KJVHGCRFSA-N
SMILES:C[C@]12[C@@]3(C)C([C@]4([C@@](C)(CC3)[C@H](O)[C@H](O)C(C)(C)C4)[H])=CC[C@@]1([C@]5(C)[C@@](CC2)([C@](CO)(C)[C@@H](O)CC5)[H])[H]
Synonyms:- (3Beta,21Beta,22Beta)-Olean-12-Ene-3,21,22,24-Tetrol
- (3Beta,5Xi,18Alpha,21Beta,22Beta)-Olean-12-Ene-3,21,22,24-Tetrol
- (3β,4β,21β,22β)-Olean-12-ene-3,21,22,23-tetrol
- Olean-12-ene-3,21,22,23-tetrol, (3beta,4beta,21beta,22beta)-
- Olean-12-ene-3,21,22,23-tetrol, (3β,4β,21β,22β)-
- Olean-12-ene-3β,21β,22β,24-tetrol
- Soyasapogenol A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(3R,4S,4aR,6aS,6bR,8aR,9S,10S,12aR,12bR,14bS)-9-(Hydroxymethyl)-2,2,4a,6a,6b,9,12a-heptamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-3,4,10-triol
CAS:(3R,4S,4aR,6aS,6bR,8aR,9S,10S,12aR,12bR,14bS)-9-(Hydroxymethyl)-2,2,4a,6a,6b,9,12a-heptamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-3,4,10-triolPurity:97%Molecular weight:474.73g/molSoyasapogenol A
CAS:Soyasapogenol A is a natural triterpene that inhibits hepatocyte apoptosis, and suppresses elevated plasma TNF-α levels.Formula:C30H50O4Purity:99.13%Color and Shape:SolidMolecular weight:474.72Soyasapogenol a
CAS:Cyclic alcoholFormula:C30H50O4Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:474.73Soyasapogenol A
CAS:Controlled Product<p>Applications Soyasapogenol A (cas# 508-01-0) is a useful research chemical.<br></p>Formula:C30H50O4Color and Shape:NeatMolecular weight:474.72Soyasapogenol A
CAS:Controlled ProductSoyasapogenol A is a naturally occurring triterpenoid, extracted from the soy plant (Glycine max). It is part of the larger group of saponins, which are secondary metabolites widely present in various plant species. The mode of action of Soyasapogenol A involves interaction with cellular membranes, where it can modulate membrane dynamics and influence signal transduction pathways through its amphipathic structure. This compound has been of interest due to its potential anti-inflammatory, antioxidant, and anticancer activities.Formula:C30H50O4Purity:Min. 95%Color and Shape:PowderMolecular weight:474.72 g/mol







