CAS 508-79-2

3,5,14,19-tetrahydroxybufa-20,22-dienolide

Description:

3,5,14,19-tetrahydroxybufa-20,22-dienolide, with the CAS number 508-79-2, is a naturally occurring compound classified as a bufanolide, which is a type of steroidal lactone. This substance is characterized by its unique tetracyclic structure, which includes multiple hydroxyl (-OH) groups at the 3, 5, 14, and 19 positions, contributing to its hydrophilicity and potential biological activity. The presence of the dienolide moiety indicates that it contains a conjugated double bond system, which can influence its reactivity and interactions with biological targets. This compound has been studied for its pharmacological properties, including potential anti-inflammatory and anticancer activities, attributed to its ability to modulate various cellular pathways. Its solubility and stability can be affected by the hydroxyl groups, making it an interesting subject for further research in medicinal chemistry and natural product studies. Overall, 3,5,14,19-tetrahydroxybufa-20,22-dienolide exemplifies the complexity and diversity of natural compounds with significant biological implications.

Formula: C₂₄H₃₄O₆

InChI: InChI=1/C24H34O6/c1-21-8-5-18-19(6-10-23(28)12-16(26)4-9-22(18,23)14-25)24(21,29)11-7-17(21)15-2-3-20(27)30-13-15/h2-3,13,16-19,25-26,28-29H,4-12,14H2,1H3

SMILES: CC12CCC3C(CCC4(CC(CCC34CO)O)O)C2(CCC1c1ccc(=O)oc1)O

Hellebrigenol

CAS: 508-79-2

Hellebrigenol

Purity: ≥95%

Molecular weight: 418.52g/mol

Ref: 54-BUP21537

Hellebrigenol

CAS: 508-79-2

Formula: C₂₄H₃₄O₆

Purity: 95%~99%

Molecular weight: 418.53

Ref: BP-BP4922

Hellebrigenol

CAS: 508-79-2

Hellebrigenol is a butadienolide extracted from the venom of the Vietnamese toad (Bufo vulgaris) with antitumor activity.

Formula: C₂₄H₃₄O₆

Purity: >99.99% - >99.99%

Color and Shape: Solid

Molecular weight: 418.523

Ref: TM-TN1729

Hellebrigenol

CAS: 508-79-2

Hellebrigenol is a steroidal saponin compound, which is derived from plants of the Helleborus genus, commonly known as hellebores. This compound is extracted from natural botanical sources through meticulous processes involving purification and characterization techniques.

Formula: C₂₄H₃₄O₆

Purity: Min. 95%

Molecular weight: 418.50 g/mol

Ref: 3D-AAA50879