CAS 50801-29-1
:3,4,6-tri-O-acetyl-1,2-O-(1-methoxyethylidene)hexopyranose
Description:
3,4,6-Tri-O-acetyl-1,2-O-(1-methoxyethylidene)hexopyranose is a carbohydrate derivative characterized by its complex structure, which includes multiple acetyl groups and a methoxyethylidene moiety. This compound is typically derived from hexopyranose sugars, such as glucose or galactose, and is used in organic synthesis and carbohydrate chemistry. The presence of three acetyl groups indicates that it has been modified to enhance its stability and solubility, making it more suitable for various chemical reactions. The methoxyethylidene group introduces additional reactivity and can influence the compound's physical properties, such as melting point and solubility in organic solvents. This compound is often utilized in the synthesis of more complex carbohydrates or as an intermediate in the production of glycosides. Its unique structure allows for specific interactions in biological systems, making it of interest in medicinal chemistry and biochemistry. As with many carbohydrate derivatives, it is essential to handle this compound with care, considering its potential reactivity and the need for appropriate safety measures in laboratory settings.
Formula:C15H22O10
InChI:InChI=1/C15H22O10/c1-7(16)20-6-10-11(21-8(2)17)12(22-9(3)18)13-14(23-10)25-15(4,19-5)24-13/h10-14H,6H2,1-5H3
SMILES:CC(=O)OCC1C(C(C2C(O1)OC(C)(OC)O2)OC(=O)C)OC(=O)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3,4,6-Tri-O-acetyl-alpha-D-galactopyranose 1,2-(Methyl Orthoacetate)
CAS:Controlled ProductApplications 3,4,6-Tri-O-acetyl-α-D-galactopyranose 1,2-(Methyl Orthoacetate) (cas# 50801-29-1) is a compound useful in organic synthesis.
Formula:C15H22O10Color and Shape:NeatMolecular weight:362.333,4,6-Tri-O-acetyl-a-D-galactopyranose 1,2-(methyl orthoacetate)
CAS:The survey was conducted to understand the current workforce and their feedback on the automated testing. The median number of respondents exceeded the number that was needed for a statistically significant result. The automated testing has helped to reduce the time it takes to test new features and has also improved the resilience of the developers. Feedback from testers has been positive, with many saying that they would recommend automated testing to other companies. This survey was conducted by an analyst who had an understanding of human-computer interaction and software development.Formula:C15H22O10Purity:Min. 95%Molecular weight:362.33 g/mol


