CAS 50802-21-6

Tingenone

Description:

Tingenone, with the CAS number 50802-21-6, is a naturally occurring chemical compound classified as a terpenoid. It is primarily derived from certain plant species, particularly those in the genus *Tingenia*. Tingenone exhibits a complex molecular structure characterized by multiple rings and functional groups, which contribute to its biological activity. This compound is known for its potential pharmacological properties, including anti-inflammatory and antimicrobial effects, making it of interest in medicinal chemistry and natural product research. Its solubility can vary depending on the solvent, and it may display varying degrees of stability under different environmental conditions. As with many terpenoids, Tingenone's characteristics can be influenced by factors such as temperature and pH. Research into Tingenone continues to explore its potential applications in pharmaceuticals and its role in traditional medicine. However, detailed studies on its toxicity and safety profile are essential for understanding its viability for therapeutic use.

Formula: C₂₈H₃₆O₃

InChI: InChI=1S/C28H36O3/c1-16-13-23-25(3,15-21(16)30)9-11-27(5)22-8-7-18-17(2)24(31)20(29)14-19(18)26(22,4)10-12-28(23,27)6/h7-8,14,16,23,31H,9-13,15H2,1-6H3/t16-,23-,25+,26+,27-,28+/m1/s1

InChI key: InChIKey=WSTYNZDAOAEEKG-GWJSGULQSA-N

SMILES: C[C@@]12[C@](C)([C@]3([C@@](C)(CC1)CC(=O)[C@H](C)C3)[H])CC[C@]4(C)C2=CC=C5C4=CC(=O)C(O)=C5C

Synonyms:

• (9β,13α,14β,20β)-3-Hydroxy-9,13-dimethyl-24,25,26,30-tetranoroleana-1(10),3,5,7-tetraene-2,21-dione
• 24,25,26,30-Tetranoroleana-1(10),3,5,7-tetraene-2,21-dione, 3-hydroxy-9,13-dimethyl-, (9β,13α,14β,20β)-
• Tingenone
• D:A-Friedo-24,30-dinoroleana-1(10),3,5,7-tetraene-2,21-dione, 3-hydroxy-, (20β)-
• Tingenin A

Tingenone

CAS: 50802-21-6

Tingenone is a pentacyclic triterpene. It induces peripheral antinociception due to opioidergic activation.

Formula: C₂₈H₃₆O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 420.593

Ref: TM-T24884