CAS 50820-64-9
:Ethyl indole-6-carboxylate
Description:
Ethyl indole-6-carboxylate is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features an ethyl ester functional group attached to the carboxylic acid at the 6-position of the indole ring. Ethyl indole-6-carboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly in the synthesis of various bioactive molecules. The compound may exhibit moderate solubility in organic solvents, while its solubility in water is generally limited due to the hydrophobic nature of the indole moiety. Additionally, it may participate in various chemical reactions, such as esterification and nucleophilic substitutions, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H11NO2
InChI:InChI=1/C11H11NO2/c1-2-14-11(13)9-4-3-8-5-6-12-10(8)7-9/h3-7,12H,2H2,1H3
Synonyms:- 6-Ethoxycarbonyl-1H-indole
- ethyl 1H-indole-6-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl indole-6-carboxylate
CAS:Formula:C11H11NO2Purity:97%Color and Shape:SolidMolecular weight:189.2105Ethyl 1H-indole-6-carboxylate
CAS:<p>Ethyl 1H-indole-6-carboxylate</p>Purity:98%Molecular weight:189.21g/molEthyl indole-6-carboxylate
CAS:<p>Ethyl indole-6-carboxylate is a chiral compound with nitrogen atoms. It has a topology and substituents, so it can be substituted in several positions. It also has nitrate, which is an ion that can carry an electric charge. This molecule can form channels and crystals with a single-crystal x-ray diffraction pattern. The hydrocarbon part of the molecule has a crystal system and framework, making it porous. The x-ray diffraction pattern of ethyl indole-6-carboxylate shows its chemistry as well.</p>Formula:C11H11NO2Purity:Min. 95%Molecular weight:189.21 g/mol
