
CAS 508229-68-3
:1,4,5,6-Tetrahydro-6-methyl-3-cyclopentapyrazolamine
Description:
1,4,5,6-Tetrahydro-6-methyl-3-cyclopentapyrazolamine, with the CAS number 508229-68-3, is a chemical compound characterized by its unique bicyclic structure, which includes a pyrazole ring fused to a cyclopentane moiety. This compound typically exhibits properties associated with nitrogen-containing heterocycles, such as potential biological activity and the ability to form hydrogen bonds due to the presence of amine groups. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. The presence of the tetrahydro configuration indicates that it is a saturated compound, which may influence its solubility and reactivity. Additionally, the methyl group at the 6-position can affect the steric and electronic properties of the molecule, potentially enhancing its interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry and material science due to its structural features and potential applications.
Formula:C7H11N3
InChI:InChI=1S/C7H11N3/c1-4-2-3-5-6(4)9-10-7(5)8/h4H,2-3H2,1H3,(H3,8,9,10)
InChI key:InChIKey=HTFJAMSHMCIJMB-UHFFFAOYSA-N
SMILES:NC=1C2=C(C(C)CC2)NN1
Synonyms:- 1,4,5,6-Tetrahydro-6-methyl-3-cyclopentapyrazolamine
- 3-Cyclopentapyrazolamine, 1,4,5,6-tetrahydro-6-methyl-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery