CAS 50825-19-9

4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine

Description:

4-(2-methyl-1H-indol-3-yl)-1,3-thiazol-2-amine, with the CAS number 50825-19-9, is a chemical compound characterized by its unique structural features, which include an indole moiety and a thiazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the indole structure often suggests possible interactions with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, the thiazole ring can enhance the compound's stability and solubility, influencing its pharmacokinetic properties. The compound may also display various functional properties, such as fluorescence or reactivity with specific biological molecules, depending on its substituents and overall molecular configuration. Its synthesis and characterization are important for understanding its potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. As with many compounds in this category, further research is necessary to fully elucidate its biological activity and potential uses.

Formula: C₁₂H₁₁N₃S

InChI: InChI=1/C12H11N3S/c1-7-11(10-6-16-12(13)15-10)8-4-2-3-5-9(8)14-7/h2-6,14H,1H3,(H2,13,15)

SMILES: Cc1c(c2ccccc2[nH]1)c1csc(=N)[nH]1

Synonyms:

• 2-Thiazolamine, 4-(2-methyl-1H-indol-3-yl)-
• 4-(2-Methyl-1H-indol-3-yl)-1,3-thiazol-2-amine
• AKOS JY2083625
• TIMTEC-BB SBB011602
• 4-(2-methyl-1H-indol-3-yl)-2-thiazolamine
• 4-(2-methyl-1H-indol-3-yl)thiazol-2-amine
• 4-(2-METHYL-1H-INDOL-3-YL)-THIAZOL-2-YLAMINE

4-(2-Methyl-1H-indol-3-yl)-thiazol-2-ylamine

CAS: 50825-19-9

Formula: C₁₂H₁₁N₃S

Molecular weight: 229.3008

Ref: IN-DA006VPR