CAS 50832-46-7

1-(5-methyl-1H-benzimidazol-2-yl)ethanone

Description:

1-(5-methyl-1H-benzimidazol-2-yl)ethanone, with the CAS number 50832-46-7, is an organic compound that features a benzimidazole moiety, which is a bicyclic structure consisting of a fused benzene and imidazole ring. This compound typically exhibits characteristics common to benzimidazole derivatives, such as potential biological activity, including antifungal and antibacterial properties. It is often used in various chemical syntheses and may serve as a building block in pharmaceuticals or agrochemicals. The presence of the ethanone functional group indicates that it has ketone characteristics, which can influence its reactivity and interactions with other molecules. The methyl group on the benzimidazole ring can affect its solubility and stability. Overall, this compound's unique structure contributes to its potential applications in medicinal chemistry and materials science, making it a subject of interest for further research and development.

Formula: C₁₀H₁₀N₂O

InChI: InChI=1/C10H10N2O/c1-6-3-4-8-9(5-6)12-10(11-8)7(2)13/h3-5H,1-2H3,(H,11,12)

SMILES: Cc1ccc2c(c1)nc(C(=O)C)[nH]2

Synonyms:

• ethanone, 1-(5-methyl-1H-benzimidazol-2-yl)-

1-(5-methyl-1H-benzimidazol-2-yl)ethanone

CAS: 50832-46-7

Formula: C₁₀H₁₀N₂O

Purity: 95.0%

Molecular weight: 174.203

Ref: 10-F311068

1-(5-Methyl-1H-benzimidazol-2-yl)ethanone

CAS: 50832-46-7

Versatile small molecule scaffold

Formula: C₁₀H₁₀N₂O

Purity: Min. 95%

Molecular weight: 174.2 g/mol

Ref: 3D-ACA83246