CAS 50834-31-6

1-[(4-Hydroxyphenyl)amino]-9,10-anthracenedione

Description:

1-[(4-Hydroxyphenyl)amino]-9,10-anthracenedione, also known as a derivative of anthraquinone, is a chemical compound characterized by its anthracene backbone substituted with an amino group and a hydroxyl group. This compound typically exhibits a deep red to brown color, which is common among anthraquinone derivatives, and it is known for its potential applications in dyeing and as a pigment. The presence of the hydroxyl group enhances its solubility in polar solvents and can influence its reactivity, making it a candidate for various chemical reactions, including those involving oxidation and reduction. Additionally, the amino group can participate in hydrogen bonding and may affect the compound's biological activity, potentially leading to applications in pharmaceuticals or as a biochemical probe. Its structure allows for strong π-π stacking interactions, which can be significant in solid-state properties and interactions with other molecules. Overall, this compound's unique functional groups and structural features contribute to its versatility in various chemical and industrial applications.

Formula: C₂₀H₁₃NO₃

InChI: InChI=1S/C20H13NO3/c22-13-10-8-12(9-11-13)21-17-7-3-6-16-18(17)20(24)15-5-2-1-4-14(15)19(16)23/h1-11,21-22H

InChI key: InChIKey=OCVSIIQVYUIGSL-UHFFFAOYSA-N

SMILES: N(C1=C2C(C(=O)C=3C(C2=O)=CC=CC3)=CC=C1)C4=CC=C(O)C=C4

Synonyms:

• 1-(p-Hydroxyanilino)anthraquinone
• 9,10-Anthracenedione, 1-[(4-hydroxyphenyl)amino]-
• Anthraquinone, 1-p-hydroxyanilino-
• 1-[(4-Hydroxyphenyl)amino]-9,10-anthracenedione