CAS 50841-47-9
:2-[3,5-bis(benzyloxy)phenyl]oxirane
Description:
2-[3,5-bis(benzyloxy)phenyl]oxirane, with the CAS number 50841-47-9, is an organic compound characterized by its epoxide functional group, which is a three-membered cyclic ether. This compound features a phenyl ring substituted with two benzyloxy groups at the 3 and 5 positions, enhancing its stability and reactivity. The presence of the oxirane ring contributes to its potential as a reactive intermediate in various organic synthesis reactions, particularly in the formation of larger, more complex molecules. The benzyloxy substituents can influence the compound's solubility, polarity, and reactivity, making it useful in medicinal chemistry and materials science. Additionally, the compound's structure suggests potential applications in polymer chemistry, where epoxides are often utilized as monomers or cross-linking agents. Overall, 2-[3,5-bis(benzyloxy)phenyl]oxirane is notable for its unique structural features and potential utility in synthetic organic chemistry.
Formula:C22H20O3
InChI:InChI=1/C22H20O3/c1-3-7-17(8-4-1)14-23-20-11-19(22-16-25-22)12-21(13-20)24-15-18-9-5-2-6-10-18/h1-13,22H,14-16H2
SMILES:c1ccc(cc1)COc1cc(cc(c1)OCc1ccccc1)C1CO1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Terbutaline Impurity 33
CAS:Formula:C22H20O3Color and Shape:White To Off-White SolidMolecular weight:332.399[3,5-Bis(phenylmethoxy)phenyl]oxirane
CAS:Controlled ProductApplications An intermediate for the preparation of Terbutaline.
Formula:C22H20O3Color and Shape:NeatMolecular weight:332.39


