CymitQuimica logo

CAS 50845-87-9

:

ethyl (5-methylthiophen-2-yl)(oxo)acetate

Description:
Ethyl (5-methylthiophen-2-yl)(oxo)acetate, with the CAS number 50845-87-9, is an organic compound characterized by its ester functional group and the presence of a thiophene ring. This compound features a 5-methyl substitution on the thiophene, which contributes to its unique chemical properties and potential reactivity. The oxo group indicates the presence of a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic additions. Ethyl (5-methylthiophen-2-yl)(oxo)acetate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, making it useful in organic synthesis and potentially in pharmaceutical applications. The compound's structure suggests it may exhibit interesting biological activities, which could be explored in medicinal chemistry. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C9H10O3S
InChI:InChI=1/C9H10O3S/c1-3-12-9(11)8(10)7-5-4-6(2)13-7/h4-5H,3H2,1-2H3
SMILES:CCOC(=O)C(=O)c1ccc(C)s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.