CAS 50870-61-6
:2-bromocyclohex-2-en-1-one
Description:
2-Bromocyclohex-2-en-1-one is an organic compound characterized by its cyclic structure and the presence of both a bromine atom and a carbonyl group. It features a cyclohexene ring, which is a six-membered carbon ring with one double bond, and the carbonyl group (C=O) is located at the first position of the ring. The bromine atom is attached to the second carbon of the double bond, contributing to the compound's reactivity. This compound is typically a colorless to pale yellow liquid and is known for its potential applications in organic synthesis, particularly in the formation of various derivatives through electrophilic substitution reactions. Its reactivity is influenced by the presence of the double bond and the electron-withdrawing nature of the carbonyl group, making it a useful intermediate in the synthesis of more complex molecules. Additionally, 2-bromocyclohex-2-en-1-one may exhibit specific physical properties such as boiling point and solubility, which are important for its handling and application in laboratory settings.
Formula:C6H7BrO
InChI:InChI=1/C6H7BrO/c7-5-3-1-2-4-6(5)8/h3H,1-2,4H2
SMILES:C1CCC(=O)C(=C1)Br
Synonyms:- 2-Cyclohexen-1-one, 2-bromo-
- 2-Bromocyclohex-2-en-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Bromocyclohex-2-en-1-one
CAS:<p>2-Bromocyclohex-2-en-1-one is a reactive compound that belongs to the group of organometallic compounds. It is utilized in polyphosphoric acid production, where it reacts with hydrocarbons and alcohols to form esters or ethers. This compound may also be used as an intermediate in the preparation of Taxol, which is a drug used to treat cancer. 2-Bromocyclohex-2-en-1-one has shown enantioselective reactions with chloride ion and chiral trifluoroacetic acid, leading to the formation of enolate anion. The reaction mechanism for this process is still not fully understood.</p>Formula:C6H7BrOPurity:Min. 95%Molecular weight:175.02 g/mol
