CAS 5088-75-5: Neoliquiritin
Description:Neoliquiritin is a flavonoid compound derived from licorice root, specifically from Glycyrrhiza glabra. It is known for its potential health benefits, including anti-inflammatory, antioxidant, and antimicrobial properties. Neoliquiritin is characterized by its yellowish color and is soluble in organic solvents, while exhibiting limited solubility in water. The compound has a molecular formula that reflects its complex structure, which includes multiple hydroxyl groups contributing to its biological activity. Neoliquiritin is often studied for its role in traditional medicine and its potential applications in food and pharmaceutical industries. Additionally, it has been investigated for its ability to modulate various biological pathways, making it a subject of interest in research related to chronic diseases and metabolic disorders. Its safety profile and efficacy are still under investigation, but it is generally considered to have a favorable safety record when consumed in moderate amounts as part of herbal preparations.
Formula:C21H22O9
InChI:InChI=1S/C21H22O9/c22-9-17-18(25)19(26)20(27)21(30-17)28-12-5-6-13-14(24)8-15(29-16(13)7-12)10-1-3-11(23)4-2-10/h1-7,15,17-23,25-27H,8-9H2/t15-,17+,18+,19-,20+,21+/m0/s1
InChI key:InChIKey=HJBUYKZTEBZNSH-ZRWXNEIDSA-N
SMILES:O=C1C2=CC=C(OC3OC(CO)C(O)C(O)C3O)C=C2OC(C4=CC=C(O)C=C4)C1
- Synonyms:
- Neoliquiritin
- Liquiritigenin 7-β-D-glucopyranoside
- 4′,7-Dihydroxyflavanone 7-(β-D-glucoside)
- (2S)-7-(β-D-Glucopyranosyloxy)-2,3-dihydro-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 7-(β-D-glucopyranosyloxy)-2,3-dihydro-2-(4-hydroxyphenyl)-, (2S)-
