CAS 5088-75-5
:Neoliquiritin
Description:
Neoliquiritin is a flavonoid compound derived from licorice root, specifically from Glycyrrhiza glabra. It is known for its potential health benefits, including anti-inflammatory, antioxidant, and antimicrobial properties. Neoliquiritin is characterized by its yellowish color and is soluble in organic solvents, while exhibiting limited solubility in water. The compound has a molecular formula that reflects its complex structure, which includes multiple hydroxyl groups contributing to its biological activity. Neoliquiritin is often studied for its role in traditional medicine and its potential applications in food and pharmaceutical industries. Additionally, it has been investigated for its ability to modulate various biological pathways, making it a subject of interest in research related to chronic diseases and metabolic disorders. Its safety profile and efficacy are still under investigation, but it is generally considered to have a favorable safety record when consumed in moderate amounts as part of herbal preparations.
Formula:C21H22O9
InChI:InChI=1S/C21H22O9/c22-9-17-18(25)19(26)20(27)21(30-17)28-12-5-6-13-14(24)8-15(29-16(13)7-12)10-1-3-11(23)4-2-10/h1-7,15,17-23,25-27H,8-9H2/t15-,17+,18+,19-,20+,21+/m0/s1
InChI key:InChIKey=HJBUYKZTEBZNSH-ZRWXNEIDSA-N
SMILES:O=C1C=2C(O[C@@H](C1)C3=CC=C(O)C=C3)=CC(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)=CC2
Synonyms:- Neoliquiritin
- Liquiritigenin 7-β-D-glucopyranoside
- 4′,7-Dihydroxyflavanone 7-(β-D-glucoside)
- (2S)-7-(β-D-Glucopyranosyloxy)-2,3-dihydro-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 7-(β-D-glucopyranosyloxy)-2,3-dihydro-2-(4-hydroxyphenyl)-, (2S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Neoliquiritin
CAS:Neoliquiritin may possess ytotoxiciy and Tumor-specificity.Formula:C21H22O9Purity:97.84% - 99.09%Color and Shape:SolidMolecular weight:418.39Neoliquiritin
CAS:Natural glycosideFormula:C21H22O9Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:418.39Neoliquiritin
CAS:Neoliquiritin is a flavonoid compound, which is derived from the root of the licorice plant, Glycyrrhiza glabra. This compound exhibits significant antioxidant properties through its ability to scavenge free radicals, thereby reducing oxidative stress within biological systems. Neoliquiritin is primarily utilized in scientific research to explore its potential therapeutic effects, particularly its anti-inflammatory and antioxidant activities. Its mode of action involves modulation of various cellular signaling pathways associated with inflammation and oxidative damage, making it a subject of interest in studies related to chronic diseases and skin conditions. Researchers investigate its potential in mitigating oxidative stress-related cellular damage, offering insights into its possible applications in pharmacology and dermatology.Formula:C21H22O9Purity:Min. 95%Color and Shape:PowderMolecular weight:418.39 g/mol







