CymitQuimica logo

CAS 50884-83-8

:

1-benzyl-5-ethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione

Description:
1-Benzyl-5-ethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione, with CAS number 50884-83-8, is a synthetic organic compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing nitrogen atoms. This compound features multiple substituents, including a benzyl group, an ethyl group, and a phenyl group, which contribute to its unique chemical properties and potential biological activity. The presence of the trione functional groups indicates that it contains three carbonyl (C=O) functionalities, which can influence its reactivity and interactions in various chemical environments. Typically, compounds of this nature may exhibit properties such as solubility in organic solvents, potential for hydrogen bonding, and reactivity in nucleophilic or electrophilic reactions. Additionally, due to its structural complexity, it may possess interesting pharmacological properties, making it a subject of interest in medicinal chemistry. However, specific applications and biological activities would require further investigation and research to elucidate its full potential.
Formula:C19H18N2O3
InChI:InChI=1/C19H18N2O3/c1-2-19(15-11-7-4-8-12-15)16(22)20-18(24)21(17(19)23)13-14-9-5-3-6-10-14/h3-12H,2,13H2,1H3,(H,20,22,24)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • (±)-Benzylphenobarbital

    Controlled Product
    CAS:
    Formula:C19H18N2O3
    Color and Shape:Neat
    Molecular weight:322.358

    Ref: TR-B144120

    100mg
    1,008.00€