CAS 50886-63-0
:Cyclopeptine
Description:
Cyclopeptine, with the CAS number 50886-63-0, is a cyclic peptide that exhibits a unique structure characterized by a closed-loop formation of amino acids. This compound is known for its potential biological activity, particularly in the realm of pharmacology and biochemistry. Cyclopeptine typically displays a range of properties, including solubility in polar solvents, which is common among peptides, and it may exhibit varying degrees of stability depending on environmental conditions such as pH and temperature. The cyclic nature of cyclopeptine often contributes to its conformational rigidity, which can enhance its binding affinity to biological targets, making it of interest in drug development. Additionally, cyclopeptine may possess antimicrobial or cytotoxic properties, although specific biological activities can vary based on its structural modifications. As with many peptides, its synthesis can involve solid-phase peptide synthesis techniques, and its characterization often requires methods such as mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy to confirm its structure and purity.
Formula:C17H16N2O2
InChI:InChI=1S/C17H16N2O2/c1-19-15(11-12-7-3-2-4-8-12)16(20)18-14-10-6-5-9-13(14)17(19)21/h2-10,15H,11H2,1H3,(H,18,20)/t15-/m0/s1
InChI key:InChIKey=KSQNKZMAMGACTL-HNNXBMFYSA-N
SMILES:O=C1C=2C(NC(=O)[C@H](CC3=CC=CC=C3)N1C)=CC=CC2
Synonyms:- 1H-1,4-Benzodiazepine-2,5-dione, 3,4-dihydro-4-methyl-3-(phenylmethyl)-, (S)-
- 1H-1,4-Benzodiazepine-2,5-dione, 3,4-dihydro-4-methyl-3-(phenylmethyl)-, (3S)-
- Cyclopeptine
- (3S)-3,4-Dihydro-4-methyl-3-(phenylmethyl)-1H-1,4-benzodiazepine-2,5-dione
- (S)-3-Benzyl-4-methyl-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Cyclopeptine
CAS:Cyclopeptine is a natural product that can be used as a reference standard. The CAS number of Cyclopeptine is 50886-63-0.Formula:C17H16N2O2Color and Shape:SolidMolecular weight:280.327
