CymitQuimica logo

CAS 50896-04-3

:

(±)-Cyclohexylphenylglycolic acid

Description:
(±)-Cyclohexylphenylglycolic acid, with the CAS number 50896-04-3, is a chiral compound that belongs to the class of glycolic acids. It features a cyclohexyl group and a phenyl group attached to a glycolic acid backbone, which contributes to its unique properties. This compound is typically characterized by its ability to form hydrogen bonds due to the presence of hydroxyl (-OH) and carboxylic acid (-COOH) functional groups, which can influence its solubility and reactivity. It is often studied for its potential applications in pharmaceuticals and as a chiral building block in organic synthesis. The presence of both cyclohexyl and phenyl groups can impart hydrophobic characteristics, affecting its interaction with biological membranes and other organic compounds. Additionally, the compound's chirality may lead to different biological activities or pharmacological effects depending on the specific enantiomer. Overall, (±)-Cyclohexylphenylglycolic acid is of interest in various fields, including medicinal chemistry and materials science, due to its structural features and potential applications.
Formula:C14H18O3
InChI:InChI=1S/C14H18O3/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-4,7-8,12,17H,2,5-6,9-10H2,(H,15,16)
InChI key:InChIKey=YTRNSQPXEDGWMR-UHFFFAOYSA-N
SMILES:C(C(O)=O)(O)(C1CCCCC1)C2=CC=CC=C2
Synonyms:
  • α-Cyclohexyl-α-phenylglycolic acid
  • Benzeneacetic acid, α-cyclohexyl-α-hydroxy-
  • α-Phenylcyclohexylglycolic acid
  • α-Cyclohexyl-α-hydroxybenzeneacetic acid
  • Cyclohexaneglycolic acid, α-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.