CymitQuimica logo

CAS 509-38-6

:

Tetraphyllicine

Description:
Tetraphyllicine, with the CAS number 509-38-6, is a chemical compound that belongs to the class of alkaloids. It is characterized by its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. This compound is known for its potential pharmacological properties, including effects on the central nervous system and possible applications in medicinal chemistry. Tetraphyllicine may exhibit various solubility characteristics depending on its specific functional groups, influencing its behavior in biological systems and its interactions with other molecules. Additionally, it may undergo various chemical reactions, such as oxidation or reduction, which can alter its properties and efficacy. As with many alkaloids, it is essential to handle tetraphyllicine with care due to its potential toxicity and the need for proper safety measures in laboratory settings. Further research is often required to fully understand its mechanisms of action and potential therapeutic uses.
Formula:C20H24N2O
InChI:InChI=1S/C20H24N2O/c1-3-11-10-22-15-8-12(11)17-16(22)9-20(19(17)23)13-6-4-5-7-14(13)21(2)18(15)20/h3-7,12,15-19,23H,8-10H2,1-2H3/b11-3-/t12-,15-,16-,17-,18-,19?,20+/m0/s1
InChI key:InChIKey=VBEQZFNVRMPLSM-AXGXPEOUSA-N
SMILES:OC1[C@]23[C@]([C@]4(N5[C@@](C2)([C@@]1([C@@](C4)(/C(=C\C)/C5)[H])[H])[H])[H])(N(C)C=6C3=CC=CC6)[H]
Synonyms:
  • Tetraphyllicine
  • Tetraphyllicin
  • Serpinine
  • (17R,19E)-19,20-Didehydroajmalan-17-ol
  • Ajmalan-17-ol, 19,20-didehydro-, (17R,19E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.