CAS 5090-87-9
:3,6,9-trimethyl-2,3-dihydrobenzo[de]chromene-7,8-dione
Description:
3,6,9-trimethyl-2,3-dihydrobenzo[de]chromene-7,8-dione, with the CAS number 5090-87-9, is a synthetic organic compound belonging to the class of chromenes, which are characterized by their fused benzene and pyran rings. This compound features a chromene backbone with three methyl groups at the 3, 6, and 9 positions, contributing to its unique structural and chemical properties. The presence of the diketone functional groups at positions 7 and 8 enhances its reactivity and potential applications in organic synthesis. Typically, compounds of this nature exhibit interesting biological activities, including antioxidant and anti-inflammatory properties, making them of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on the solvent and environmental conditions, which are crucial for its practical applications. Additionally, its molecular structure may allow for various modifications, leading to derivatives with enhanced or altered properties. Overall, 3,6,9-trimethyl-2,3-dihydrobenzo[de]chromene-7,8-dione represents a versatile scaffold in organic chemistry and pharmacology.
Formula:C15H14O3
InChI:InChI=1/C15H14O3/c1-7-4-5-10-8(2)6-18-15-9(3)13(16)14(17)11(7)12(10)15/h4-5,8H,6H2,1-3H3
SMILES:Cc1ccc2C(C)COC3=C(C)C(=O)C(=O)c1c23
Synonyms:- Naphtho(1,8-bc)pyran-7,8-dione, 2,3-dihydro-3,6,9-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
