CAS 50903-75-8
:Z-Ala-Ile-OH
Description:
Z-Ala-Ile-OH, also known as Z-Ala-Isoleucine, is a peptide derivative characterized by the presence of a Z (benzyloxycarbonyl) protecting group on the amino acid alanine (Ala) and isoleucine (Ile) at the C-terminus. This compound is typically used in peptide synthesis and research due to its stability and ability to protect amino groups during chemical reactions. The Z group enhances the solubility and stability of the peptide in various solvents, making it suitable for various applications in biochemistry and medicinal chemistry. The structure of Z-Ala-Ile-OH includes a carboxylic acid functional group, which is crucial for its reactivity and interactions in biological systems. As a synthetic intermediate, it can be utilized in the development of more complex peptides and proteins. Its CAS number, 50903-75-8, allows for easy identification and reference in chemical databases. Overall, Z-Ala-Ile-OH serves as an important building block in peptide chemistry, contributing to the synthesis of bioactive compounds.
Formula:C17H24N2O5
InChI:InChI=1/C17H24N2O5/c1-4-11(2)14(16(21)22)19-15(20)12(3)18-17(23)24-10-13-8-6-5-7-9-13/h5-9,11-12,14H,4,10H2,1-3H3,(H,18,23)(H,19,20)(H,21,22)
SMILES:CCC(C)C(C(=O)O)N=C(C(C)N=C(O)OCc1ccccc1)O
Synonyms:- N-[(benzyloxy)carbonyl]alanylisoleucine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Z-Ala-Ile-OH
CAS:Z-Ala-Ile-OH is a hydroxamic acid that is used in peptide synthesis. It is a monomer that is hydrophobic and has an affinity for peptidyl acceptors. The synthetic method for Z-Ala-Ile-OH involves the use of aspartic acid and aspartate semialdehyde, which are used to synthesize the hydroxamic acid via an amidation reaction. The nomenclature of Z-Ala-Ile-OH is based on its structure and the order of amino acids found in it. Aspartic acid and asparagine are both amino acids found in Z-Ala-Ile-OH, with the -NH2 group being replaced by -OH in this particular molecule. This substitution results in a more hydrophobic compound than aspartate semialdehyde.
Formula:C17H24N2O5Purity:Min. 95%Molecular weight:336.38 g/mol
