CAS 50906-56-4: (7R)-7,9a-dimethyl-4-methylidenedecahydro-3H-oxireno[7,8]naphtho[8a,1-b]furan-3-one
Description:The chemical substance known as (7R)-7,9a-dimethyl-4-methylidenedecahydro-3H-oxireno[7,8]naphtho[8a,1-b]furan-3-one, with the CAS number 50906-56-4, is a complex organic compound characterized by its unique bicyclic structure that incorporates both furan and oxirane functionalities. This compound features multiple chiral centers, which contribute to its stereochemistry and potential biological activity. The presence of dimethyl and methylidene groups indicates a degree of substitution that can influence its reactivity and interaction with other molecules. Typically, such compounds may exhibit interesting properties, including potential use in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific arrangement of atoms and functional groups can also affect its solubility, stability, and reactivity under various conditions. While detailed studies on this particular compound may be limited, its structural characteristics suggest it could be of interest in fields such as medicinal chemistry or materials science.
Formula:C15H20O3
InChI:InChI=1/C15H20O3/c1-8-4-5-11-9(2)12(16)17-15(11)10(8)6-7-14(3)13(15)18-14/h8,10-11,13H,2,4-7H2,1,3H3/t8-,10?,11?,13?,14?,15?/m1/s1
![(7R)-7,9a-dimethyl-4-methylidenedecahydro-3H-oxireno[7,8]naphtho[8a,1-b]furan-3-one](https://static.cymitquimica.com/cas-image/303344-7r-79a-dimethyl-4-methylidenedecahydro-3h-oxireno-78-naphtho-8a-1-b-furan-3-one.png)
