CAS 50906-56-4
:(7R)-7,9a-dimethyl-4-methylidenedecahydro-3H-oxireno[7,8]naphtho[8a,1-b]furan-3-one
Description:
The chemical substance known as (7R)-7,9a-dimethyl-4-methylidenedecahydro-3H-oxireno[7,8]naphtho[8a,1-b]furan-3-one, with the CAS number 50906-56-4, is a complex organic compound characterized by its unique bicyclic structure that incorporates both furan and oxirane functionalities. This compound features multiple chiral centers, which contribute to its stereochemistry and potential biological activity. The presence of dimethyl and methylidene groups indicates a degree of substitution that can influence its reactivity and interaction with other molecules. Typically, such compounds may exhibit interesting properties, including potential use in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific arrangement of atoms and functional groups can also affect its solubility, stability, and reactivity under various conditions. While detailed studies on this particular compound may be limited, its structural characteristics suggest it could be of interest in fields such as medicinal chemistry or materials science.
Formula:C15H20O3
InChI:InChI=1/C15H20O3/c1-8-4-5-11-9(2)12(16)17-15(11)10(8)6-7-14(3)13(15)18-14/h8,10-11,13H,2,4-7H2,1,3H3/t8-,10?,11?,13?,14?,15?/m1/s1
SMILES:C[C@@H]1CCC2C(=C)C(=O)OC32C1CCC1(C)C3O1
Synonyms:- Arteannuin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Arteannuin B
CAS:Arteannuin B and artemisinic acid are biogenetic precursors of artemisinin, an important antimalarial produced by the herb Artemisia annua, they are active against different bacteria and certain fungal species. Arteannuin B has potential antimalarialand antitumor activity.Formula:C15H20O3Purity:95%~99%Color and Shape:PowderMolecular weight:248.322Arteannuin B
CAS:1. Arteannuin B has potent antimalarial activity.Formula:C15H20O3Purity:98% - 99.8%Color and Shape:SolidMolecular weight:248.32Arteannuin B
CAS:Arteannuin B is a sesquiterpene lactone, which is primarily derived from species within the Artemisia genus, such as Artemisia annua. This compound belongs to the artemisinin family and is biosynthesized through the mevalonate pathway in these plants. Its mode of action involves the generation of reactive oxygen species upon activation by heme iron in the parasite, leading to oxidative stress and damage to the cellular components of Plasmodium species, the causative agents of malaria.Formula:C15H20O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:248.32 g/mol






