CAS 50907-19-2

5-(2-fluorophenyl)-1H-1,2,3,4-tetraazole

Description:

5-(2-Fluorophenyl)-1H-1,2,3,4-tetrazole is a chemical compound characterized by its tetrazole ring, which is a five-membered aromatic heterocycle containing four nitrogen atoms and one carbon atom. The presence of a 2-fluorophenyl group enhances its chemical properties, potentially influencing its reactivity and solubility. This compound is typically used in various applications, including pharmaceuticals and agrochemicals, due to its ability to act as a bioactive molecule. The fluorine atom in the phenyl group can enhance lipophilicity and metabolic stability, making it an interesting candidate for drug development. The compound's structure allows for various functionalization possibilities, which can be exploited in synthetic chemistry. Additionally, its unique properties may contribute to its role in coordination chemistry or as a ligand in metal complexes. As with many nitrogen-containing heterocycles, it may exhibit interesting biological activities, warranting further investigation into its potential uses in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₇H₅FN₄

InChI: InChI=1/C7H5FN4/c8-6-4-2-1-3-5(6)7-9-11-12-10-7/h1-4H,(H,9,10,11,12)

SMILES: c1ccc(c(c1)c1n[nH]nn1)F

Synonyms:

• 5-(2-fluorophenyl)-2H-tetrazole

5-(2-FLUOROPHENYL)-1H-1,2,3,4-TETRAAZOLE

CAS: 50907-19-2

Formula: C₇H₅FN₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 164.1398

Ref: IN-DA003M3S

5-(2-Fluorophenyl)-1H-tetrazole

Controlled Product

CAS: 50907-19-2

Applications 5-(2-Fluorophenyl)-1H-tetrazole is used in the synthetic preparation of novel tetrazole derivatives as positive allosteric modulators of metabotropic glutamate receptors useful in treatment and prevention of CNS diseases and diseases-modulated by mGluR5 receptors.
References Gagliardi, S.; et al.: PCT Int. Appl. 45 pp. Patent 2006 CODEN:PIXXD2

Formula: C₇H₅FN₄

Color and Shape: White To Beige

Molecular weight: 164.14

Ref: TR-F632230

5-(2-fluorophenyl)-2H-1,2,3,4-tetrazole

CAS: 50907-19-2

Purity: 98%(LC-MS);RG

Color and Shape: Solid

Molecular weight: 164.1430054

Ref: 10-F641191

5-(2-FLUOROPHENYL)TETRAZOLE

CAS: 50907-19-2

Purity: 98%

Molecular weight: 164.1430054

Ref: 10-F831935

5-(2-Fluorophenyl)-1H-tetrazole

CAS: 50907-19-2

5-(2-Fluorophenyl)-1H-tetrazole

Purity: ≥95%

Color and Shape: Off-White Solid

Molecular weight: 164.14g/mol

Ref: 54-PC3845