CAS 50907-21-6

5-(4-Fluorophenyl)-1H-tetrazole

Description:

5-(4-Fluorophenyl)-1H-tetrazole is a chemical compound characterized by its tetrazole ring, which is a five-membered aromatic heterocycle containing four nitrogen atoms and one carbon atom. The presence of a 4-fluorophenyl group enhances its chemical properties, making it a subject of interest in various fields, including pharmaceuticals and agrochemicals. This compound typically exhibits good solubility in organic solvents and may have moderate stability under standard conditions. Its structure allows for potential interactions with biological targets, which can be explored for medicinal applications. The fluorine substituent can influence the compound's lipophilicity and metabolic stability, potentially affecting its bioactivity. Additionally, tetrazoles are known for their ability to form hydrogen bonds, which can play a crucial role in molecular interactions. Overall, 5-(4-Fluorophenyl)-1H-tetrazole is a versatile compound with significant implications in chemical research and development.

Formula: C₇H₅FN₄

InChI: InChI=1/C7H5FN4/c8-6-3-1-5(2-4-6)7-9-11-12-10-7/h1-4H,(H,9,10,11,12)

SMILES: c1cc(ccc1c1n[nH]nn1)F

Synonyms:

• 5-(4-fluorophenyl)-2H-tetrazole

5-(4-FLUORO-PHENYL)-2H-TETRAZOLE

CAS: 50907-21-6

Formula: C₇H₅FN₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 164.1398

Ref: IN-DA00D8D5

5-(4-fluorophenyl)-1H-1,2,3,4-tetrazole

CAS: 50907-21-6

Purity: 98%

Molecular weight: 164.1430054

Ref: 10-F863530

5-(4-Fluorophenyl)-2H-tetrazole

CAS: 50907-21-6

5-(4-Fluorophenyl)-2H-tetrazole

Purity: 98%

Color and Shape: Solid

Molecular weight: 164.14g/mol

Ref: 54-PC200591