CAS 509072-57-5
:2,2-Difluorocyclopropylmethanol
Description:
2,2-Difluorocyclopropylmethanol is a chemical compound characterized by its unique structure, which includes a cyclopropyl ring and two fluorine atoms attached to the second carbon of the ring. This compound features a hydroxymethyl group (-CH2OH) that contributes to its reactivity and potential applications in organic synthesis. The presence of fluorine atoms enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the cyclopropyl moiety can impart strain, which may lead to interesting chemical behavior, such as increased reactivity in certain reactions. The compound is typically handled with standard safety precautions due to the presence of fluorine, which can be toxic in certain contexts. Its specific applications may vary, but it is often explored in the development of pharmaceuticals or agrochemicals due to its structural features. As with any chemical, proper characterization and understanding of its properties are essential for safe handling and application in research or industrial settings.
Formula:C4H6F2O
InChI:InChI=1/C4H6F2O/c5-4(6)1-3(4)2-7/h3,7H,1-2H2
SMILES:C1C(CO)C1(F)F
Synonyms:- 2,2-Difluorocyclopropanemethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,2-Difluorocyclopropanemethanol, 97%
CAS:<p>2,2-Difluorocyclopropanemethanol is used as an intermediate in the preparation of (2,2-difluorocyclopropyl)methylamine. It is also used as a reagent in the synthesis of pyrrolopyridine derivatives, which finds application as an antiviral agent. This Thermo Scientific Chemicals brand product was orig</p>Formula:C4H6F2OPurity:97%Color and Shape:Clear colorless, LiquidMolecular weight:108.092,2-Difluorocyclopropylmethanol
CAS:Formula:C4H6F2OPurity:97%Color and Shape:LiquidMolecular weight:108.0866Ref: IN-DA003BKF
1g126.00€5g361.00€10g571.00€25gTo inquire100gTo inquire100mg55.00€250mg64.00€500mg122.00€2,2-Difluorocyclopropylmethanol
CAS:Formula:C4H6F2OPurity:97.0%Color and Shape:OilMolecular weight:108.088(2,2-Difluorocyclopropyl)methanol
CAS:(2,2-Difluorocyclopropyl)methanolFormula:C4H6F2OPurity:≥95%Color and Shape: clear. almost colourless liquidMolecular weight:108.09g/mol(2,2-Difluorocyclopropyl)methanol
CAS:Controlled ProductFormula:C4H6F2OColor and Shape:NeatMolecular weight:108.087




