CAS 509114-15-2

N-[4-iodo-2-(propan-2-yl)phenyl]benzamide

Description:

N-[4-iodo-2-(propan-2-yl)phenyl]benzamide, with the CAS number 509114-15-2, is an organic compound characterized by its complex structure, which includes an amide functional group and a substituted aromatic system. The presence of the iodine atom introduces notable properties, such as increased molecular weight and potential for unique reactivity due to the halogen's electronegativity. The isopropyl group contributes to the compound's hydrophobic characteristics, influencing its solubility in organic solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential interactions with biological targets, which could be explored in pharmacological studies. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the iodine and the steric hindrance from the isopropyl group. Overall, N-[4-iodo-2-(propan-2-yl)phenyl]benzamide represents a versatile molecule with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₆H₁₆INO

InChI: InChI=1/C16H16INO/c1-11(2)14-10-13(17)8-9-15(14)18-16(19)12-6-4-3-5-7-12/h3-11H,1-2H3,(H,18,19)

SMILES: CC(C)c1cc(ccc1N=C(c1ccccc1)O)I

Synonyms:

• benzamide, N-[4-iodo-2-(1-methylethyl)phenyl]-
• N-(4-Iodo-2-isopropylphenyl)benzamide

N-(4-iodo-2-isopropylphenyl)benzamide

CAS: 509114-15-2

Formula: C₁₆H₁₆INO

Purity: 95.0%

Molecular weight: 365.214

Ref: 10-F315328