CAS 509142-48-7

4-bromo-2-(trifluoromethoxy)benzoic acid

Description:

4-Bromo-2-(trifluoromethoxy)benzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and a trifluoromethoxy group attached to a benzoic acid framework. The molecular structure features a benzene ring with a carboxylic acid (-COOH) functional group, which contributes to its acidic properties. The trifluoromethoxy group (-OCF3) enhances the compound's lipophilicity and can influence its reactivity and interaction with biological systems. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique electronic properties, due to the electronegative fluorine atoms, can affect its acidity and reactivity. Additionally, the presence of bromine can facilitate further substitution reactions. As with many halogenated compounds, it is essential to handle 4-bromo-2-(trifluoromethoxy)benzoic acid with care, considering potential environmental and health impacts. Proper safety measures should be observed during its use in laboratory or industrial settings.

Formula: C₈H₄BrF₃O₃

InChI: InChI=1/C8H4BrF3O3/c9-4-1-2-5(7(13)14)6(3-4)15-8(10,11)12/h1-3H,(H,13,14)

SMILES: c1cc(c(cc1Br)OC(F)(F)F)C(=O)O

Synonyms:

• Benzoic Acid, 4-Bromo-2-(Trifluoromethoxy)-

4-Bromo-2-(trifluoromethoxy)benzoic acid

CAS: 509142-48-7

Formula: C₈H₄BrF₃O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 285.0148

Ref: IN-DA003KVE

4-Bromo-2-(trifluoromethoxy)benzoic acid

CAS: 509142-48-7

4-Bromo-2-(trifluoromethoxy)benzoic acid

Purity: 98%

Molecular weight: 285.01g/mol

Ref: 54-PC502695

4-Bromo-2-(trifluoromethoxy)benzoic acid

CAS: 509142-48-7

Formula: C₈H₄BrF₃O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 285.016

Ref: 10-F219252