
CAS 509145-82-8
:N2-[cis-4-[[2-[4-Bromo-2-(trifluoromethoxy)phenyl]ethyl]amino]cyclohexyl]-N4,N4-dimethyl-2,4-quinazolinediamine
Description:
N2-[cis-4-[[2-[4-Bromo-2-(trifluoromethoxy)phenyl]ethyl]amino]cyclohexyl]-N4,N4-dimethyl-2,4-quinazolinediamine, with CAS number 509145-82-8, is a synthetic organic compound characterized by its complex molecular structure, which includes a quinazoline core, a cyclohexyl group, and a bromo-substituted phenyl moiety. This compound exhibits properties typical of small-molecule pharmaceuticals, potentially acting as a kinase inhibitor or in other therapeutic roles. Its trifluoromethoxy group enhances lipophilicity, which may influence its bioavailability and interaction with biological targets. The presence of multiple functional groups suggests that it may engage in various chemical interactions, including hydrogen bonding and π-π stacking, which are crucial for its biological activity. Additionally, the compound's stereochemistry, particularly the cis configuration, may play a significant role in its pharmacodynamics and pharmacokinetics. Overall, this compound represents a class of targeted therapies that are being explored for their potential in treating various diseases, including cancer.
Formula:C25H29BrF3N5O
InChI:InChI=1/C25H29BrF3N5O/c1-34(2)23-20-5-3-4-6-21(20)32-24(33-23)31-19-11-9-18(10-12-19)30-14-13-16-7-8-17(26)15-22(16)35-25(27,28)29/h3-8,15,18-19,30H,9-14H2,1-2H3,(H,31,32,33)/t18-,19+
InChI key:InChIKey=FWKVXHBRMCTKHZ-KDURUIRLNA-N
SMILES:N(C)(C)C=1C2=C(N=C(N[C@H]3CC[C@@H](NCCC4=C(OC(F)(F)F)C=C(Br)C=C4)CC3)N1)C=CC=C2
Synonyms:- N2-[cis-4-[[2-[4-Bromo-2-(trifluoromethoxy)phenyl]ethyl]amino]cyclohexyl]-N4,N4-dimethyl-2,4-quinazolinediamine
- 2,4-Quinazolinediamine, N2-[cis-4-[[2-[4-bromo-2-(trifluoromethoxy)phenyl]ethyl]amino]cyclohexyl]-N4,N4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
ATC0065
CAS:ATC0065 is a melanin-concentrating hormone receptor 1 antagonist with oral activity.Formula:C25H29BrF3N5OColor and Shape:SolidMolecular weight:552.43
