CAS 50918-26-8

[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetic acid

Description:

[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetic acid, with the CAS number 50918-26-8, is a chemical compound characterized by the presence of a thiadiazole ring and a sulfanyl group attached to an acetic acid moiety. This compound typically exhibits properties associated with both the thiadiazole and carboxylic acid functional groups, including potential acidity due to the carboxylic acid group and the ability to participate in various chemical reactions due to the presence of sulfur and nitrogen atoms in the thiadiazole ring. The methyl group on the thiadiazole ring can influence the compound's solubility and reactivity. Such compounds may have applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis due to their unique structural features. Additionally, the presence of sulfur can impart specific biological activities, making it of interest in medicinal chemistry. Overall, this compound's characteristics are defined by its functional groups, molecular structure, and potential reactivity in various chemical environments.

Formula: C₅H₆N₂O₂S₂

InChI: InChI=1/C5H6N2O2S2/c1-3-6-7-5(11-3)10-2-4(8)9/h2H2,1H3,(H,8,9)

SMILES: Cc1nnc(SCC(=O)O)s1

Synonyms:

• Acetic Acid, 2-[(5-Methyl-1,3,4-Thiadiazol-2-Yl)Thio]-

2-((5-Methyl-1,3,4-thiadiazol-2-yl)thio)acetic acid

CAS: 50918-26-8

Formula: C₅H₆N₂O₂S₂

Molecular weight: 190.2433

Ref: IN-DA00D9C3

[(5-methyl-1,3,4-thiadiazol-2-yl)thio]acetic acid

CAS: 50918-26-8

Formula: C₅H₆N₂O₂S₂

Purity: 95.0%

Molecular weight: 190.24

Ref: 10-F308316