CAS 50919-06-7
:2-(2-Fluorophenyl)ethanol
Description:
2-(2-Fluorophenyl)ethanol, with the CAS number 50919-06-7, is an organic compound characterized by the presence of a fluorophenyl group attached to a two-carbon ethanol backbone. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents, reflecting its hydrophobic nature due to the aromatic ring. The fluorine atom in the para position of the phenyl ring can influence the compound's reactivity and polarity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the hydroxyl (-OH) group contributes to its potential as a hydrogen bond donor, which can affect its interactions in biological systems. Additionally, 2-(2-Fluorophenyl)ethanol may exhibit unique properties such as altered boiling and melting points compared to its non-fluorinated counterparts, due to the electronegative fluorine atom. Its synthesis typically involves the reaction of appropriate precursors, and it can serve as an intermediate in the production of more complex organic molecules.
Formula:C8H9FO
InChI:InChI=1/C8H9FO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6H2
SMILES:c1ccc(c(c1)CCO)F
Synonyms:- 2-Fluorophenethyl Alcohol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-(2-Fluorophenyl)ethanol, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H9FOPurity:99%Color and Shape:Clear colorless, LiquidMolecular weight:140.162-(2-Fluorophenyl)ethanol
CAS:Formula:C8H9FOPurity:98%Color and Shape:LiquidMolecular weight:140.15492-(2-Fluorophenyl)ethanol
CAS:Formula:C8H9FOPurity:>95.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:140.162-Fluorophenethyl alcohol
CAS:Formula:C8H9FOPurity:98%Color and Shape:Liquid, ClearMolecular weight:140.157





