CymitQuimica logo

CAS 50920-47-3

:

1-Ethyl-5-methyl-4-nitro-1H-pyrazole-3-carboxylic acid

Description:
1-Ethyl-5-methyl-4-nitro-1H-pyrazole-3-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl group and a methyl group as substituents, along with a nitro group and a carboxylic acid functional group, contributing to its chemical reactivity and potential applications. The presence of the nitro group typically enhances the compound's polarity and can influence its biological activity. The carboxylic acid group provides acidic properties, allowing for potential interactions in various chemical environments. This compound may be of interest in medicinal chemistry and agricultural applications, particularly as a potential herbicide or fungicide, due to its structural characteristics. Its solubility, stability, and reactivity can vary based on environmental conditions, making it important to consider these factors in practical applications. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C7H9N3O4
InChI:InChI=1S/C7H9N3O4/c1-3-9-4(2)6(10(13)14)5(8-9)7(11)12/h3H2,1-2H3,(H,11,12)
InChI key:InChIKey=FVAMWYRRWJUYMO-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(C(O)=O)=NN(CC)C1C
Synonyms:
  • 1-Ethyl-5-methyl-4-nitro-1H-pyrazole-3-carboxylic acid
  • 1H-Pyrazole-3-carboxylic acid, 1-ethyl-5-methyl-4-nitro-
  • 1-Ethyl-5-methyl-4-nitropyrazole-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.