CAS 50932-19-9
:Verminoside
Description:
Verminoside, with the CAS number 50932-19-9, is a chemical compound that belongs to the class of glycosides, specifically a type of saponin. It is primarily derived from plant sources, particularly from the genus *Vernonia*, which is known for its medicinal properties. Verminoside exhibits a range of biological activities, including anti-inflammatory, antimicrobial, and potential antitumor effects, making it of interest in pharmacological research. The compound is characterized by its complex structure, which typically includes a sugar moiety linked to a steroid or triterpenoid aglycone. Its solubility properties can vary, often being more soluble in polar solvents due to the presence of sugar units. Verminoside's safety profile and toxicity are still subjects of ongoing research, but it is generally considered to have low toxicity in the context of its natural sources. As with many natural products, the extraction and purification processes can influence its bioactivity and stability, which are important considerations for its application in herbal medicine and potential therapeutic uses.
Formula:C24H28O13
InChI:InChI=1S/C24H28O13/c25-8-14-17(30)18(31)19(32)23(34-14)36-22-16-11(5-6-33-22)20(21-24(16,9-26)37-21)35-15(29)4-2-10-1-3-12(27)13(28)7-10/h1-7,11,14,16-23,25-28,30-32H,8-9H2/b4-2+/t11-,14-,16-,17-,18+,19-,20+,21+,22+,23+,24-/m1/s1
InChI key:InChIKey=MZQXNUBTVLKMLP-QOEJBJAYSA-N
SMILES:C(O)[C@@]12[C@@](O1)([C@@H](OC(/C=C/C3=CC(O)=C(O)C=C3)=O)[C@]4([C@@]2([C@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)OC=C4)[H])[H])[H]
Synonyms:- Oxireno[4,5]cyclopenta[1,2-c]pyran, β-D-glucopyranoside deriv.
- β-D-Glucopyranoside, (1aS,1bS,2S,5aR,6S,6aS)-6-[[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1a,1b,2,5a,6,6a-hexahydro-1a-(hydroxymethyl)oxireno[4,5]cyclopenta[1,2-c]pyran-2-yl
- β-D-Glucopyranoside, 6-[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1a,1b,2,5a,6,6a-hexahydro-1a-(hydroxymethyl)oxireno[4,5]cyclopenta[1,2-c]pyran-2-yl, [1aS-[1aα,1bβ,2β,5aβ,6β(E),6aα]]-
- (1aS,1bS,2S,5aR,6S,6aS)-6-[[(2E)-3-(3,4-Dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1a,1b,2,5a,6,6a-hexahydro-1a-(hydroxymethyl)oxireno[4,5]cyclopenta[1,2-c]pyran-2-yl β-D-glucopyranoside
- β-D-Glucopyranoside, (1aS,1bS,2S,5aR,6S,6aS)-6-[[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1a,1b,2,5a,6,6a-hexahydro-1a-(hydroxymethyl)oxireno[4,5]cyclopenta[1,2-c]pyran-2-yl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
[(1aS)-6α-[[(E)-3-(3,4-Dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1a,1bα,2,5aα,6,6aβ-hexahydro-1a-hydroxymethyloxireno[4,5]cyclopenta[1,2-c]pyran-2α-yl]β-D-glucopyranoside
CAS:Formula:C24H28O13Purity:97.5%Molecular weight:524.4713Verminoside
CAS:Verminoside is a natural iridoid isolated from Kigelia africana, with anti-inflammatory and remarkable antioxidant activity.Formula:C24H28O13Purity:98%Color and Shape:SolidMolecular weight:524.47Verminoside
CAS:<p>Verminoside is a natural glycoside compound, which is derived from plant sources, particularly from the genus *Verbena* and *Buddleja*. It exhibits a range of pharmacological actions, primarily through its antioxidant and anti-inflammatory mechanisms. By scavenging free radicals and modulating inflammatory pathways, Verminoside effectively contributes to cellular protection and the mitigation of oxidative stress-induced damage.</p>Purity:Min. 95%



