CAS 5096-49-1

(+)-Anacrotine

Description:

(+)-Anacrotine, with the CAS number 5096-49-1, is a naturally occurring alkaloid primarily derived from the plant species of the Anacardium genus, particularly the cashew tree. This compound is characterized by its chiral nature, existing as a single enantiomer, which contributes to its biological activity. It typically exhibits a complex molecular structure, featuring multiple functional groups that can influence its solubility and reactivity. (+)-Anacrotine is known for its potential pharmacological properties, including anti-inflammatory and analgesic effects, making it of interest in medicinal chemistry. Its stereochemistry plays a crucial role in its interaction with biological targets, which can lead to varying effects compared to its enantiomer. Additionally, the compound's stability and behavior in different environments can be influenced by factors such as pH and temperature. Research continues to explore its applications and mechanisms of action, highlighting the importance of understanding its chemical characteristics for potential therapeutic uses.

Formula: C₁₈H₂₅NO₆

InChI: InChI=1S/C18H25NO6/c1-4-11-7-10(2)18(3,23)17(22)24-9-12-5-6-19-8-13(20)15(14(12)19)25-16(11)21/h4-5,10,13-15,20,23H,6-9H2,1-3H3/b11-4-/t10-,13-,14-,15-,18-/m1/s1

InChI key: InChIKey=NPYPUYCITBTPSF-TZCAYXSXSA-N

SMILES: O[C@H]1[C@@]2([C@@]3(N(C1)CC=C3COC(=O)[C@](C)(O)[C@H](C)C\C(=C\C)\C(=O)O2)[H])[H]

Synonyms:

• (3Z,5R,6R,14R,14aS,14bR)-3-Ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6,14-dihydroxy-5,6-dimethyl[1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione
• Senecionan-11,16-dione, 6,12-dihydroxy-, (6β)-
• [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine, senecionan-11,16-dione deriv.
• [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6,14-dihydroxy-5,6-dimethyl-, (3Z,5R,6R,14R,14aS,14bR)-
• Anacrotine

Anacrotine

CAS: 5096-49-1

Formula: C₁₈H₂₅NO₆

Purity: 95%~99%

Color and Shape: Cryst.

Molecular weight: 351.399

Ref: BP-BPC0345

Anacrotine

CAS: 5096-49-1

Anacrotine is a naturally-derived alkaloid, which is sourced from plants belonging to the genus Delphinium. It exhibits its mode of action primarily through the induction of apoptosis in cancer cells. This apoptotic pathway is initiated through the modulation of mitochondrial membrane potential and the activation of caspase enzymes, leading to programmed cell death in malignant cells.

Formula: C₁₈H₂₅NO₆

Purity: Min. 95%

Molecular weight: 351.40 g/mol

Ref: 3D-FAA09649