CAS 5097-95-0
:1,1′-Thiobis[2-chlorobenzene]
Description:
1,1′-Thiobis[2-chlorobenzene], with the CAS number 5097-95-0, is an organic compound characterized by its structure, which features two 2-chlorobenzene groups connected by a sulfur atom. This compound is part of the class of thioethers and is known for its aromatic properties due to the presence of the chlorobenzene rings. It typically appears as a solid at room temperature and is insoluble in water but may dissolve in organic solvents. The presence of chlorine atoms in the benzene rings contributes to its reactivity and potential applications in various chemical processes, including synthesis and as an intermediate in organic chemistry. Additionally, the compound may exhibit specific physical properties such as melting and boiling points that are influenced by its molecular structure. Safety data should be consulted, as compounds containing chlorine can pose health risks, and appropriate handling procedures should be followed. Overall, 1,1′-Thiobis[2-chlorobenzene] is of interest in both industrial and research settings due to its unique chemical characteristics.
Formula:C12H8Cl2S
InChI:InChI=1S/C12H8Cl2S/c13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14/h1-8H
InChI key:InChIKey=JJMLCWKZDOCOPH-UHFFFAOYSA-N
SMILES:S(C1=C(Cl)C=CC=C1)C2=C(Cl)C=CC=C2
Synonyms:- 1,1′-Dithiobis(2-chlorobenzene)
- 1,1′-Thiobis[2-chlorobenzene]
- Bis(2-chlorophenyl) sulfide
- Sulfide, bis(o-chlorophenyl)
- Benzene, 1,1′-thiobis[2-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
