CAS 5098-14-6: Propanedinitrile, 2-amino-, 4-methylbenzenesulfonate (1:1)
Description:Propanedinitrile, 2-amino-, 4-methylbenzenesulfonate (1:1), with the CAS number 5098-14-6, is a chemical compound that features a sulfonate group attached to a substituted aromatic ring. This compound typically exhibits characteristics associated with both its amine and sulfonate functional groups, including potential solubility in polar solvents and the ability to participate in various chemical reactions, such as nucleophilic substitutions. The presence of the propanedinitrile moiety suggests that it may have applications in organic synthesis or as an intermediate in the production of other chemical entities. Additionally, the compound may display biological activity due to the amino group, which can influence its interaction with biological systems. Its structural features may also confer specific physical properties, such as melting and boiling points, which are influenced by intermolecular forces like hydrogen bonding and dipole-dipole interactions. Overall, this compound's unique combination of functional groups makes it of interest in both synthetic and medicinal chemistry contexts.
Formula:C7H8O3S·C3H3N3
InChI:InChI=1S/C7H8O3S.C3H3N3/c1-6-2-4-7(5-3-6)11(8,9)10;4-1-3(6)2-5/h2-5H,1H3,(H,8,9,10);3H,6H2
InChI key:InChIKey=MEUWQVWJLLBVQI-UHFFFAOYSA-N
SMILES:N#CC(C#N)N.O=S(=O)(O)C1=CC=C(C=C1)C
- Synonyms:
- 2-Aminomalononitrile 4-methylbenzenesulfonate
- 2-Aminomalononitrile tosylate
- 2-Aminopropanedinitrile 4-methylbenzenesulfonate
- Aminomalonitrile tosylate
- Aminomalononitrile p-toluenesulphonate
- Aminomalononitrile tosylate
- Aminopropanedinitrile 4-Methylbenzenesulfonate (1:1)
- Animomalononitrile p-toluenosulfunic acid
- Malononitrile, amino-, p-toluenesulfonate
- Propanedinitrile, 2-amino-, 4-methylbenzenesulfonate (1:1)
- See more synonyms
- Propanedinitrile, amino-, mono(4-methylbenzenesulfonate)
