CAS 50991-93-0
:methyl 2-amino-2-deoxy-alpha-D-mannopyranoside
Description:
Methyl 2-amino-2-deoxy-alpha-D-mannopyranoside, with the CAS number 50991-93-0, is a derivative of mannose, a six-carbon sugar. This compound features an amino group and a methyl ether, which contribute to its unique chemical properties. It is typically a white to off-white solid, soluble in water due to the presence of hydroxyl groups, which facilitate hydrogen bonding. The amino group enhances its reactivity, making it useful in various biochemical applications, including glycosylation reactions and as a building block in the synthesis of glycosides and oligosaccharides. Its structure allows it to participate in interactions with biological molecules, potentially influencing cellular processes. Methyl 2-amino-2-deoxy-alpha-D-mannopyranoside is often used in research settings, particularly in studies related to carbohydrate chemistry and glycobiology. As with many sugar derivatives, it may exhibit biological activity, and its derivatives can be explored for therapeutic applications. Proper handling and storage conditions are essential to maintain its stability and reactivity.
Formula:C7H15NO5
InChI:InChI=1/C7H15NO5/c1-12-7-4(8)6(11)5(10)3(2-9)13-7/h3-7,9-11H,2,8H2,1H3/t3-,4+,5-,6-,7+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Methyl 2-amino-2-deoxy-a-D-mannopyranoside
CAS:<p>Methyl 2-amino-2-deoxy-a-D-mannopyranoside is a fluorinated monosaccharide, which can be synthesized from the natural amino acid L -lysine. It is an important building block for complex carbohydrates and polysaccharides. Methyl 2-amino-2-deoxy-a-D-mannopyranoside can also be used to modify glycosyl groups, methyl groups, and sugar molecules.</p>Formula:C7H15NO5Purity:Min. 95%Molecular weight:193.2 g/mol
