CymitQuimica logo

CAS 50995-74-9

:

7-(diethylamino)coumarin-3-carboxylic acid

Description:
7-(Diethylamino)coumarin-3-carboxylic acid is a synthetic organic compound belonging to the coumarin family, characterized by its distinct fluorescent properties. This compound features a coumarin backbone, which is a benzopyrone structure, and is substituted with a diethylamino group at the 7-position and a carboxylic acid group at the 3-position. The presence of the diethylamino group enhances its solubility in polar solvents and contributes to its photophysical properties, making it useful in various applications, including fluorescence microscopy and as a fluorescent probe in biochemical assays. The carboxylic acid functionality allows for potential interactions with biological molecules, facilitating its use in biological studies. Additionally, the compound exhibits strong absorption and emission characteristics, which are valuable in the development of fluorescent dyes. Overall, 7-(diethylamino)coumarin-3-carboxylic acid is notable for its versatility in research and industrial applications, particularly in the fields of biochemistry and materials science.
Formula:C14H15NO4
InChI:InChI=1/C14H15NO4/c1-9-12(10(2)19-15-9)8-18-13-5-4-11(7-16)6-14(13)17-3/h4-7H,8H2,1-3H3
InChI key:WHCPTFFIERCDSB-UHFFFAOYSA-N
SMILES:Cc1c(COc2ccc(cc2OC)C=O)c(C)on1
Synonyms:
  • 7-Diethylaminocoumarin-3-carboxylic acid
  • 7-(Diethylamino)-2-oxo-2H-chromene-3-carboxylic acid
  • 4-[(3,5-Dimethyl-1,2-Oxazol-4-Yl)Methoxy]-3-Methoxybenzaldehyde
Found 8 products.