CAS 50998-17-9

6-bromoquinoxaline

Description:

6-Bromoquinoxaline is a heterocyclic organic compound characterized by the presence of a bromine atom at the 6-position of the quinoxaline ring system. This compound features a bicyclic structure composed of two fused aromatic rings, specifically a benzene and a pyrazine ring. It is typically a pale yellow to off-white solid, exhibiting moderate solubility in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). The presence of the bromine substituent can influence its reactivity and properties, making it a useful intermediate in organic synthesis and medicinal chemistry. 6-Bromoquinoxaline is often studied for its potential biological activities, including antimicrobial and anticancer properties, due to the quinoxaline framework's ability to interact with various biological targets. Additionally, it can serve as a building block for the synthesis of more complex molecules in pharmaceutical research. As with many brominated compounds, care should be taken regarding its handling and disposal due to potential environmental and health impacts.

Formula: C₈H₅BrN₂

InChI: InChI=1/C8H5BrN2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-5H

SMILES: c1cc2c(cc1Br)nccn2

Synonyms:

• Quinoxaline, 6-bromo-

6-Bromoquinoxaline

CAS: 50998-17-9

Formula: C₈H₅BrN₂

Purity: >98.0%(GC)

Color and Shape: White to Yellow to Orange powder to crystal

Molecular weight: 209.05

Ref: 3B-B4476

6-Bromoquinoxaline

CAS: 50998-17-9

Formula: C₈H₅BrN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 209.0427

Ref: IN-DA0034CJ

6-Bromoquinoxaline

CAS: 50998-17-9

6-Bromoquinoxaline

Formula: C₈H₅BrN₂

Purity: 97%

Color and Shape: yellow solid

Molecular weight: 209.04g/mol

Ref: 54-OR23162

6-Bromo-quinoxaline

CAS: 50998-17-9

Formula: C₈H₅BrN₂

Purity: 97%

Color and Shape: Brown powder

Molecular weight: 209.046

Ref: 10-F037028