CAS 51-14-9
:Sesamex
Description:
Sesamex, with the CAS number 51-14-9, is a chemical compound known as sesamol, which is a phenolic compound derived from sesame oil. It is characterized by its antioxidant properties, making it valuable in various applications, particularly in food preservation and cosmetics. Sesamex exhibits a light yellow to brownish color and has a distinctive aromatic odor. It is soluble in organic solvents like ethanol and ether but has limited solubility in water. The compound is known for its ability to scavenge free radicals, thereby protecting cells from oxidative stress. Additionally, sesamex has been studied for its potential health benefits, including anti-inflammatory and anti-cancer properties. Its stability and effectiveness as a natural preservative make it a popular choice in formulations aimed at enhancing shelf life and maintaining product integrity. Overall, sesamex is a versatile compound with significant implications in both food science and health-related research.
Formula:C15H22O6
InChI:InChI=1S/C15H22O6/c1-3-16-6-7-17-8-9-18-12(2)21-13-4-5-14-15(10-13)20-11-19-14/h4-5,10,12H,3,6-9,11H2,1-2H3
InChI key:InChIKey=WABPPBHOPMUJHV-UHFFFAOYSA-N
SMILES:O(C(OCCOCCOCC)C)C=1C=C2C(=CC1)OCO2
Synonyms:- 5-[1-[2-(2-Ethoxyethoxy)ethoxy]ethoxy]-1,3-benzodioxole
- ENT 20,871
- 3,6,9-Trioxaundecane, 2-(3,4-methylenedioxyphenoxy)-
- Acetaldehyde, 2-(2-ethoxyethoxy)ethyl 3,4-(methylenedioxy)phenyl acetal
- 1,3-Benzodioxole, 5-[1-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
