CAS 51-27-4

5-Ethyl-2-hydroxybenzoic acid

Description:

5-Ethyl-2-hydroxybenzoic acid, also known as ethyl salicylate, is an aromatic compound characterized by a hydroxyl group (-OH) and a carboxylic acid group (-COOH) attached to a benzene ring. This compound features an ethyl group (-C2H5) at the 5-position of the benzene ring, which influences its solubility and reactivity. It is typically a white to off-white crystalline solid with a melting point that varies based on purity and specific conditions. The presence of both the hydroxyl and carboxylic acid functional groups contributes to its acidity and potential for hydrogen bonding, making it soluble in polar solvents like water and alcohols. 5-Ethyl-2-hydroxybenzoic acid is often used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Additionally, it exhibits potential biological activity, which can be explored in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₉H₁₀O₃

InChI: InChI=1S/C9H10O3/c1-2-6-3-4-8(10)7(5-6)9(11)12/h3-5,10H,2H2,1H3,(H,11,12)

InChI key: InChIKey=WYIAFSIUYJGIPU-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(CC)=CC=C1O

Synonyms:

• 5-Ethylsalicylic acid
• Benzoic acid, 5-ethyl-2-hydroxy-
• 5-Ethyl-2-hydroxybenzoic acid
• Salicylic acid, 5-ethyl-

5-Ethyl-2-hydroxybenzoic acid

CAS: 51-27-4

Formula: C₉H₁₀O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 166.1739

Ref: IN-DA003MQ1

5-Ethyl-2-hydroxybenzoic acid

CAS: 51-27-4

5-Ethyl-2-hydroxybenzoic acid

Purity: 95%

Molecular weight: 166.17g/mol

Ref: 54-OR926276

5-ethyl-2-hydroxybenzoic acid

CAS: 51-27-4

Formula: C₉H₁₀O₃

Purity: >97%

Molecular weight: 166.176

Ref: 10-F356152

5-Ethyl-2-hydroxybenzoic acid

CAS: 51-27-4

5-Ethyl-2-hydroxybenzoic acid has the chemical nature of a phenol and is also known as salicylic acid. It is a monosubstituted aromatic carboxylic acid with a methoxy group. The hydroxyl group on this molecule interacts with the hydroxyl group on adjacent molecules to form hydrogen bonds, which gives it stability. Salicylic acid reacts with 4-methoxybenzoic acid to produce 2,4-dihydroxybenzoic acid and salicylic acid. Salicylic acid can also react with ascorbic acid to produce 2,5-dihydroxybenzoic acid and salicylic acid. Salicylic acid can also react with benzoic acids to produce 4-hydroxybenzoic and 2,4,6-trihydroxybenzoic acids.

Formula: C₉H₁₀O₃

Purity: Min. 95%

Molecular weight: 166.18 g/mol

Ref: 3D-AAA05127