CAS 510-30-5
:Echinocystic acid
Description:
Echinocystic acid, with the CAS number 510-30-5, is a triterpenoid compound primarily derived from the plant Echinocystis lobata, commonly known as the spiny cucumber. This compound is characterized by its pentacyclic structure, which is typical of many triterpenoids, and features a carboxylic acid functional group. Echinocystic acid exhibits various biological activities, including anti-inflammatory and potential anticancer properties, making it of interest in pharmacological research. It is generally insoluble in water but soluble in organic solvents, which is a common trait among many lipophilic compounds. The substance has been studied for its effects on cellular processes and its potential therapeutic applications. Additionally, its structural characteristics contribute to its interaction with biological membranes and proteins, influencing its bioactivity. Overall, echinocystic acid represents a significant compound in natural product chemistry, with ongoing research into its properties and applications in medicine.
Formula:C30H48O4
InChI:InChI=1S/C30H48O4/c1-25(2)14-15-30(24(33)34)19(16-25)18-8-9-21-27(5)12-11-22(31)26(3,4)20(27)10-13-28(21,6)29(18,7)17-23(30)32/h8,19-23,31-32H,9-17H2,1-7H3,(H,33,34)/t19-,20-,21+,22-,23+,27-,28+,29+,30+/m0/s1
InChI key:InChIKey=YKOPWPOFWMYZJZ-PRIAQAIDSA-N
SMILES:C(O)(=O)[C@]12[C@](C=3[C@@](C)(C[C@H]1O)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)(C(C)(C)[C@@H](O)CC5)[H])[H])(CC(C)(C)CC2)[H]
Synonyms:- (3Beta,5Xi,9Xi,16Beta,18Xi)-3,16-Dihydroxyolean-12-En-28-Oic Acid
- (3beta,16alpha)-3,16-Dihydroxyolean-12-en-28-oic acid
- Echinocystic acid
- Olean-12-en-28-oic acid, 3,16-dihydroxy-, (3β,16α)-
- Olean-12-en-28-oic acid, 3β,16α-dihydroxy-
- (3β,16α)-3,16-Dihydroxyolean-12-en-28-oic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
Echinocystic acid
CAS:Echinocystic acid analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C30H48O4Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:472.71Ref: IN-DA00DBAJ
1gTo inquire5gTo inquire5mg51.00€10mg64.00€20mg79.00€25mg101.00€100mg168.00€250mg294.00€Echinocystic Acid
CAS:Formula:C30H48O4Purity:>95.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:472.71Echinocystic acid
CAS:EA, a natural triterpene, is found in herbs; it has anti-inflammatory and antioxidant properties.Formula:C30H48O4Purity:98% - 99.57%Color and Shape:SolidMolecular weight:472.70Echinocystic acid
CAS:Carboxylic acid with alcohol functionFormula:C30H48O4Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:472.7Echinocystic acid
CAS:Controlled ProductEchinocystic acid is a pentacyclic triterpenoid compound, which is naturally sourced from various plant species, including those in the Sapindaceae and Araliaceae families. It is found in certain fruits, herbs, and traditional medicinal plants. The mode of action of echinocystic acid primarily involves its interaction with cellular signaling pathways. It has been shown to exhibit anti-inflammatory, antioxidant, and anticancer activities by modulating specific molecular targets and pathways, such as NF-κB and apoptosis-related proteins.
Formula:C30H48O4Purity:Min. 98 Area-%Color and Shape:White Off-White PowderMolecular weight:472.7 g/mol









