CAS 510-77-0
:Narwedine
Description:
Narwedine, with the CAS number 510-77-0, is a chemical compound that belongs to the class of alkaloids. It is primarily derived from certain plant sources and is known for its potential biological activities. Narwedine exhibits a complex molecular structure, which contributes to its pharmacological properties. The compound has been studied for its effects on various biological systems, including its potential as an anti-inflammatory and analgesic agent. Additionally, narwedine may interact with specific receptors in the body, influencing neurotransmitter activity. Its solubility characteristics can vary, affecting its bioavailability and efficacy in therapeutic applications. As with many alkaloids, narwedine's safety profile and potential side effects are important considerations in its use. Research continues to explore its full range of biological activities and potential applications in medicine. However, detailed information regarding its specific mechanisms of action and therapeutic uses may still be under investigation.
Formula:C17H19NO3
InChI:InChI=1S/C17H19NO3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17/h3-6,14H,7-10H2,1-2H3/t14-,17-/m0/s1
InChI key:InChIKey=QENVUHCAYXAROT-YOEHRIQHSA-N
SMILES:O(C)C1=C2C=3[C@]4([C@@](O2)(CC(=O)C=C4)[H])CCN(C)CC3C=C1
Synonyms:- (4aS,8aS)-3-Methoxy-11-methyl-4a,5,9,10,11,12-hexahydro-6H-[1]benzofuro[3a,3,2-ef][2]benzazepin-6-one
- (4aS,8aS)-4a,5,9,10,11,12-Hexahydro-3-methoxy-11-methyl-6H-benzofuro[3a,3,2-ef][2]benzazepin-6-one
- 6H-benzofuro[3a,3,2-ef][2]benzazepin-6-one, 4a,5,9,10,11,12-hexahydro-3-methoxy-11-methyl-, (4aS,8aS)-
- Galanthamine, 3-deoxy-3-oxo-
- Galanthaminone
- Narwedin
- Narwedine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(4aS,8aS)-4a,5,9,10,11,12-Hexahydro-3-methoxy-11-methyl-6H-benzofuro[3a,3,2-ef][2]benzazepin-6-one
CAS:Formula:C17H19NO3Purity:98%Color and Shape:SolidMolecular weight:285.3377Galantamine EP Impurity A ((-)-Narwedine, Galantaminone)
CAS:Formula:C17H19NO3Color and Shape:Off-White SolidMolecular weight:285.34GALANTHAMINONE
CAS:Galanthaminone ((-)-Narwedine) is a cholinesterase (AChE) inhibitor, used for the treatment of mild to moderate Alzheimer's disease and other memory impairments
Formula:C17H19NO3Purity:99.93%Color and Shape:White To Off-White ChemicalMolecular weight:285.34Galanthaminone
CAS:Controlled ProductGalanthaminone is an alkaloid derivative, which is naturally sourced from certain plant species, notably the Amaryllidaceae family. This compound represents a class of tertiary alkaloids known for their bioactive properties. The source of Galanthaminone primarily involves the extraction from the bulbs and leaves of plants such as Galanthus species.Formula:C17H19NO3Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:285.34 g/mol






