CymitQuimica logo

CAS 5101-00-8

:

4-oxo-4-(3,4,5-trimethoxyphenyl)butanoic acid

Description:
4-Oxo-4-(3,4,5-trimethoxyphenyl)butanoic acid, with the CAS number 5101-00-8, is an organic compound characterized by its unique structure, which includes a butanoic acid backbone with a ketone functional group and a substituted aromatic ring. The presence of three methoxy groups on the phenyl ring enhances its lipophilicity and may influence its biological activity. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical reactions and applications. It may participate in esterification or condensation reactions due to the carboxylic acid group, while the ketone can serve as a reactive site for nucleophilic attacks. Additionally, the trimethoxyphenyl moiety may contribute to the compound's potential pharmacological properties, as many compounds with similar structures are investigated for their therapeutic effects. Overall, 4-oxo-4-(3,4,5-trimethoxyphenyl)butanoic acid is a versatile compound of interest in organic synthesis and medicinal chemistry.
Formula:C13H16O6
InChI:InChI=1/C13H16O6/c1-17-10-6-8(9(14)4-5-12(15)16)7-11(18-2)13(10)19-3/h6-7H,4-5H2,1-3H3,(H,15,16)
InChI key:VBPGSDAYADHUML-UHFFFAOYSA-N
SMILES:COc1cc(cc(c1OC)OC)C(=O)CCC(=O)O
Found 2 products.