CAS 5101-44-0
:2-ethynylphenol
Description:
2-Ethynylphenol, with the CAS number 5101-44-0, is an organic compound characterized by the presence of both a phenolic hydroxyl group and an ethynyl group attached to a benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its aromatic properties and can participate in various chemical reactions due to the reactivity of the ethynyl group. 2-Ethynylphenol is soluble in organic solvents but has limited solubility in water, which is common for many phenolic compounds. It exhibits antimicrobial and antioxidant properties, making it of interest in various applications, including pharmaceuticals, agrochemicals, and materials science. Additionally, it can serve as a building block in organic synthesis, particularly in the production of more complex molecules. Safety considerations should be taken into account when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate protective measures should be employed.
Formula:C8H6O
InChI:InChI=1/C8H6O/c1-2-7-5-3-4-6-8(7)9/h1,3-6,9H
SMILES:C#Cc1ccccc1O
Synonyms:- Phenol, 2-Ethynyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Ethynylphenol
CAS:<p>2-Ethynylphenol</p>Formula:C8H6OPurity:95%Color and Shape: dark brown liquidMolecular weight:118.13g/mol2-Ethynylphenol
CAS:<p>2-Ethynylphenol is an optical and fluorescence probe that is used in the determination of nucleophilic or electrophilic reactions. It has been shown to inhibit the ring-opening polymerization of benzofuran derivatives, and has potent inhibitory activity against trifluoroacetic acid. 2-Ethynylphenol does not react with amines, halides, or hydrogen bonds, but can be used as a chiral hydrogen bond donor. 2-Ethynylphenol reacts with nucleophiles to form reaction products that are useful for determining the presence of an amine or a halide. 2-Ethynylphenol reacts with nucleophiles to form reaction products that are useful for determining the presence of an amine or a halide.</p>Formula:C8H6OPurity:Min. 95%Molecular weight:118.13 g/mol


